Popo30506 Popo30506

05-12-2020
English

contestada

8. Why would a diamond from antiquity look similar to a diamond today?

Respuesta :

jdjshwjr jdjshwjr

05-12-2020

Well because a diamond is a dimaond

Answer Link

Otras preguntas

Name two things that can happen when a country is In turmoil

which of the following are solutions to the equation sinx cos(pi/7)-sin(pi/7)cosx=sqrt(2)/2 check all that apply A. 7pi/4+pi/4+2npi B. 5pi/4+pi/7+2npi C. pi/4+

This political scientist and author of Two Treatises on Civil Government believed that no government could exist without the consent of the governed and that th

Why is the fact that Mowgli causes the herd of buffalo to trample Shere Khan the climax of this story? A. This encounter is the turning point in the story. B.

an airplane descends 1.5 miles to an elevation of 5.25 miles.find the elevation of the plane before its descent.

In the reaction C6H12 + ________ O2----> 6H20 + 6CO2, what coefficient should be placed in front of 02 to balance the reaction?

If enough changes occur in the gene pool of a species, it is possible that a new species would be created. True? False?

PLEASE HELP I NEED SOMEONE TO POST THE ANSWERS I'M VERY BEHIND -- If a mutation occurs in the gene for the lac repressor and results in a repressor that does

How does frequency change as wavelength increases? Frequency increases. Frequency decreases. Frequency is unaffected. Frequency increases or decreases depen

What is the proper weight for a 11 year old male that is exactly 5 feet high? Please answer quick

Q&A Education