sherrierivera sherrierivera

05-04-2016
Health

contestada

eating slowly is important too healthy eating and weight management because

Respuesta :

Аноним Аноним

05-04-2016

When you fast your body does not register that you have eaten that much, so when you eat faster you eat more. But when you eat slow your body registers that you have eaten that much making you eat less.

Answer Link

Otras preguntas

Which agreement rule applies to a singular collective noun functioning as a unit? use a singular verb use a plural verb make the verb agree with the subject clo

Including all coefficients, charges, and phases, what is the correct net ionic equation for the following set of reactants? Assume that the contribution of prot

The amount the bank charges for use of money is called interest. (points : 1) true false

Which of the following chemical formulas shows an ionic compound? A. CO2 B. N2O C. NaCl D. C6H12O6

solve one step equations 3 1/2 +x= 11

What term is used to identify the visual interface that displays information it receives from the computer? a. computer display b. cpu c. expansion card d.

What is the proof the formula for cos(A+B)=cosAcosB-sinAsinB?

What is needed to improve this story? This is write a story about a red blood cell trveling through the circulatory system with a Jamaican accent. Hey. What go

Successful weight loss can be best accomplished by a. using supplements. b. making small dietary changes over time. c. adhering to short-term diets. d. decr

If your heart is not strong enough or efficient enough, it is difficult to A lift weights B breathe C stretch D perspire

Q&A Education